Products 2138425-69-9
CAS 2138425-69-9 is the registry number for rac-((1R,3R)-2,2-Difluoro-3-phenylcyclopropyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[(1S,3S)-2,2-difluoro-3-phenylcyclopropyl]methanamine;hydrochloride (CAS 2138425-69-9) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: [(1S,3S)-2,2-difluoro-3-phenylcyclopropyl]methanamine;hydrochloride. InChIKey: SIMBDBWJNGBXGP-VTLYIQCISA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | [(1S,3S)-2,2-difluoro-3-phenylcyclopropyl]methanamine;hydrochloride |
| InChIKey | SIMBDBWJNGBXGP-VTLYIQCISA-N |
| SMILES | C1=CC=C(C=C1)[C@@H]2[C@H](C2(F)F)CN.Cl |
Computed by PubChem (NCBI)