Products 2148899-65-2
CAS 2148899-65-2 is the registry number for 4-(1-Bromoethyl)-3-nitrobenzoic acid. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-(1-bromoethyl)-3-nitrobenzoic acid (CAS 2148899-65-2) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: 4-(1-bromoethyl)-3-nitrobenzoic acid. InChIKey: RPTBSTBGLVJTAW-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | 4-(1-bromoethyl)-3-nitrobenzoic acid |
| InChIKey | RPTBSTBGLVJTAW-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)C(=O)O)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)
Synonyms:
4-(1-Bromoethyl)-3-nitrobenzoic acid