Products 2149003-12-1
CAS 2149003-12-1 appears in our catalog under these names: Methyl 6-amino-2,2-difluorobenzo[d][1,3]dioxole-5-carboxylate, 97%, METHYL 6-AMINO-2,2-DIFLUOROBENZO[D][1,3]DIOXOLE-5-CARBOXYLATE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Methyl 6-amino-2,2-difluoro-1,3-benzodioxole-5-carboxylate (CAS 2149003-12-1) is a chemical compound with the molecular formula C9H7F2NO4 and a molecular weight of 231.15 g/mol. IUPAC name: methyl 6-amino-2,2-difluoro-1,3-benzodioxole-5-carboxylate. InChIKey: BQAOLDPNSRCKPI-UHFFFAOYSA-N.
| Molecular formula | C9H7F2NO4 |
|---|---|
| Molecular weight | 231.15 g/mol |
| IUPAC name | methyl 6-amino-2,2-difluoro-1,3-benzodioxole-5-carboxylate |
| InChIKey | BQAOLDPNSRCKPI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1N)OC(O2)(F)F |
Computed by PubChem (NCBI)