Products 2155855-94-8

CAS 2155855-94-8 is the registry number for 4-(Methoxycarbonyl)cycloheptane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-methoxycarbonylcycloheptane-1-carboxylic acid (CAS 2155855-94-8) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: 4-methoxycarbonylcycloheptane-1-carboxylic acid. InChIKey: ABJBVSOIDOQQRW-UHFFFAOYSA-N.

Identity
Molecular formulaC10H16O4
Molecular weight200.23 g/mol
IUPAC name4-methoxycarbonylcycloheptane-1-carboxylic acid
InChIKeyABJBVSOIDOQQRW-UHFFFAOYSA-N
SMILESCOC(=O)C1CCCC(CC1)C(=O)O

Computed by PubChem (NCBI)