Products 2155874-58-9
CAS 2155874-58-9 appears in our catalog under these names: 3,3-Dimethyl-1h-pyrido[2,3-b][1,4]oxazin-2(3h)-one, 95%, 3,3-Dimethyl-1H-pyrido[2,3-b][1,4]oxazin-2(3H)-one, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 5g, 1g.
3,3-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-2-one (CAS 2155874-58-9) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 3,3-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-2-one. InChIKey: MKHSAFBKBDGEIV-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 3,3-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-2-one |
| InChIKey | MKHSAFBKBDGEIV-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(O1)N=CC=C2)C |
Computed by PubChem (NCBI)