Products 2157-52-0
CAS 2157-52-0 appears in our catalog under these names: 9–Fluorenone Oxime, 9-Fluorenone oxime, 98+% , 9-Fluorenone oxime, 9-Fluorenone Oxime, >97.0%(GC)(N), 9H-Fluoren-9-one oxime 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 25g, 5g, 50g, 1g, 100g, 250g, 10g, 500g.
N-fluoren-9-ylidenehydroxylamine (CAS 2157-52-0) is a chemical compound with the molecular formula C13H9NO and a molecular weight of 195.22 g/mol. IUPAC name: N-fluoren-9-ylidenehydroxylamine. InChIKey: CRNNFEKVPRFZKJ-UHFFFAOYSA-N.
| Molecular formula | C13H9NO |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | N-fluoren-9-ylidenehydroxylamine |
| InChIKey | CRNNFEKVPRFZKJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=CC=CC=C3C2=NO |
Computed by PubChem (NCBI)