CAS 21571-66-4 is the registry number for 4-(Ethanesulfonyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
4-ethylsulfonylbenzoic acid (CAS 21571-66-4) is a chemical compound with the molecular formula C9H10O4S and a molecular weight of 214.24 g/mol. IUPAC name: 4-ethylsulfonylbenzoic acid. InChIKey: IOMGTNZQTBFAHK-UHFFFAOYSA-N.
| Molecular formula | C9H10O4S |
|---|---|
| Molecular weight | 214.24 g/mol |
| IUPAC name | 4-ethylsulfonylbenzoic acid |
| InChIKey | IOMGTNZQTBFAHK-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)