CAS 21598-04-9 appears in our catalog under these names: 3-Methoxy-1H-indole-2-carboxylic Acid, 3-Methoxy-1H-indole-2-carboxylic acid, 95%. Offered by: TRC, AmBeed. Available pack sizes: 1g.
3-methoxy-1H-indole-2-carboxylic acid (CAS 21598-04-9) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 3-methoxy-1H-indole-2-carboxylic acid. InChIKey: CKFXYMTUUVNCIX-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 3-methoxy-1H-indole-2-carboxylic acid |
| InChIKey | CKFXYMTUUVNCIX-UHFFFAOYSA-N |
| SMILES | COC1=C(NC2=CC=CC=C21)C(=O)O |
Computed by PubChem (NCBI)