CAS 216312-53-7 appears in our catalog under these names: (S)–2–((tert–Butoxycarbonyl)amino)–3–(2–cyanophenyl)propanoic acid, (S)-2-((tert-Butoxycarbonyl)amino)-3-(2-cyanophenyl)propanoic acid, 95%, 95%, BOC-L-2-CYANOPHENYLALANINE, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
(2S)-3-(2-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 216312-53-7) is a chemical compound with the molecular formula C15H18N2O4 and a molecular weight of 290.31 g/mol. IUPAC name: (2S)-3-(2-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: AJHPGXZOIAYYDW-LBPRGKRZSA-N.
| Molecular formula | C15H18N2O4 |
|---|---|
| Molecular weight | 290.31 g/mol |
| IUPAC name | (2S)-3-(2-cyanophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | AJHPGXZOIAYYDW-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1C#N)C(=O)O |
Computed by PubChem (NCBI)