CAS 2166662-10-6 is the registry number for Ethyl 4,6-dichloro-α-oxo-3-pyridineacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-(4,6-dichloro-3-pyridinyl)-2-oxoacetate (CAS 2166662-10-6) is a chemical compound with the molecular formula C9H7Cl2NO3 and a molecular weight of 248.06 g/mol. IUPAC name: ethyl 2-(4,6-dichloro-3-pyridinyl)-2-oxoacetate. InChIKey: XKDIBMAZFRHSRK-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO3 |
|---|---|
| Molecular weight | 248.06 g/mol |
| IUPAC name | ethyl 2-(4,6-dichloro-3-pyridinyl)-2-oxoacetate |
| InChIKey | XKDIBMAZFRHSRK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)C1=CN=C(C=C1Cl)Cl |
Computed by PubChem (NCBI)