CAS 2166836-11-7 appears in our catalog under these names: Rel-(1r,3r)-3-(tert-butoxycarbonyl)cyclobutane-1-carboxylic acid, 97%, (1r,3r)-3-[(tert-butoxy)carbonyl]cyclobutane-1-carboxylic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg.
3-[(2-methylpropan-2-yl)oxycarbonyl]cyclobutane-1-carboxylic acid (CAS 2166836-11-7) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonyl]cyclobutane-1-carboxylic acid. InChIKey: SXGHENXTHRGIPQ-UHFFFAOYSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonyl]cyclobutane-1-carboxylic acid |
| InChIKey | SXGHENXTHRGIPQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CC(C1)C(=O)O |
Computed by PubChem (NCBI)