Products 2167766-74-5
CAS 2167766-74-5 is the registry number for 2-{4,4-Dioxo-4λâ¶-thia-5-azaspiro(2.5)octan-5-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(4,4-dioxo-4lambda6-thia-5-azaspiro[2.5]octan-5-yl)acetic acid (CAS 2167766-74-5) is a chemical compound with the molecular formula C8H13NO4S and a molecular weight of 219.26 g/mol. IUPAC name: 2-(4,4-dioxo-4lambda6-thia-5-azaspiro[2.5]octan-5-yl)acetic acid. InChIKey: QPPXQIWQUYFZSH-UHFFFAOYSA-N.
| Molecular formula | C8H13NO4S |
|---|---|
| Molecular weight | 219.26 g/mol |
| IUPAC name | 2-(4,4-dioxo-4lambda6-thia-5-azaspiro[2.5]octan-5-yl)acetic acid |
| InChIKey | QPPXQIWQUYFZSH-UHFFFAOYSA-N |
| SMILES | C1CC2(CC2)S(=O)(=O)N(C1)CC(=O)O |
Computed by PubChem (NCBI)