CAS 2168718-55-4 is the registry number for 5-Iodo-2-(trifluoromethoxy)benzaldehyde, ≥99.1%, ≥99.1%. Offered by: Chemat. Available pack sizes: 1g.
5-iodo-2-(trifluoromethoxy)benzaldehyde (CAS 2168718-55-4) is a chemical compound with the molecular formula C8H4F3IO2 and a molecular weight of 316.02 g/mol. IUPAC name: 5-iodo-2-(trifluoromethoxy)benzaldehyde. InChIKey: IPFREKTWNKGJOC-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IO2 |
|---|---|
| Molecular weight | 316.02 g/mol |
| IUPAC name | 5-iodo-2-(trifluoromethoxy)benzaldehyde |
| InChIKey | IPFREKTWNKGJOC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1I)C=O)OC(F)(F)F |
Computed by PubChem (NCBI)