Products 2169-98-4
CAS 2169-98-4 appears in our catalog under these names: 3,4-Dimethoxybenzaldehyde oxime, 98%, 98%, 3,4-Dimethoxybenzaldehyde oxime, 98%, 3,4-Dimethoxybenzaldehyde oxime, 95%, Veratraldoxime. Offered by: Chemat, Fluorochem, Combi-blocks, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g, 50g, 100g.
(NE)-N-[(3,4-dimethoxyphenyl)methylidene]hydroxylamine (CAS 2169-98-4) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: (NE)-N-[(3,4-dimethoxyphenyl)methylidene]hydroxylamine. InChIKey: LHZIVRAMZJJLAP-UXBLZVDNSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | (NE)-N-[(3,4-dimethoxyphenyl)methylidene]hydroxylamine |
| InChIKey | LHZIVRAMZJJLAP-UXBLZVDNSA-N |
| SMILES | COC1=C(C=C(C=C1)/C=N/O)OC |
Computed by PubChem (NCBI)