CAS 2169956-19-6 appears in our catalog under these names: (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-hydroxypentanoic acid, 98%, Fmoc-5-hydroxy-L-Nva-OH, Fmooc-5-hydroxy-L-Norvaline, 98%. Offered by: AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 2g, 5g, 100mg, 250mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-hydroxypentanoic acid (CAS 2169956-19-6) is a chemical compound with the molecular formula C20H21NO5 and a molecular weight of 355.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-hydroxypentanoic acid. InChIKey: ZJOXBTUTWNPBPW-SFHVURJKSA-N.
| Molecular formula | C20H21NO5 |
|---|---|
| Molecular weight | 355.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-hydroxypentanoic acid |
| InChIKey | ZJOXBTUTWNPBPW-SFHVURJKSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCO)C(=O)O |
Computed by PubChem (NCBI)