Products 2171802-24-5
CAS 2171802-24-5 is the registry number for 2-((2,4-Difluorophenyl)methyl)pyrrolidine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[(2,4-difluorophenyl)methyl]pyrrolidine;hydrochloride (CAS 2171802-24-5) is a chemical compound with the molecular formula C11H14ClF2N and a molecular weight of 233.68 g/mol. IUPAC name: 2-[(2,4-difluorophenyl)methyl]pyrrolidine;hydrochloride. InChIKey: OUMDWXHJKBGGEQ-UHFFFAOYSA-N.
| Molecular formula | C11H14ClF2N |
|---|---|
| Molecular weight | 233.68 g/mol |
| IUPAC name | 2-[(2,4-difluorophenyl)methyl]pyrrolidine;hydrochloride |
| InChIKey | OUMDWXHJKBGGEQ-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)CC2=C(C=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)