Products 2171999-78-1
CAS 2171999-78-1 is the registry number for 8-Cyanobicyclo(4.2.0)octa-1(6),2,4-triene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
8-cyanobicyclo[4.2.0]octa-1(6),2,4-triene-2-carboxylic acid (CAS 2171999-78-1) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: 8-cyanobicyclo[4.2.0]octa-1(6),2,4-triene-2-carboxylic acid. InChIKey: QMYALHRKRPWIKM-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | 8-cyanobicyclo[4.2.0]octa-1(6),2,4-triene-2-carboxylic acid |
| InChIKey | QMYALHRKRPWIKM-UHFFFAOYSA-N |
| SMILES | C1C(C2=C1C=CC=C2C(=O)O)C#N |
Computed by PubChem (NCBI)