CAS 2173052-14-5 is the registry number for (3R,4S)-4-(Benzyloxy)tetrahydrofuran-3-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3R,4S)-4-phenylmethoxyoxolan-3-amine;hydrochloride (CAS 2173052-14-5) is a chemical compound with the molecular formula C11H16ClNO2 and a molecular weight of 229.70 g/mol. IUPAC name: (3R,4S)-4-phenylmethoxyoxolan-3-amine;hydrochloride. InChIKey: ZTVZVAHORYFXKL-NDXYWBNTSA-N.
| Molecular formula | C11H16ClNO2 |
|---|---|
| Molecular weight | 229.70 g/mol |
| IUPAC name | (3R,4S)-4-phenylmethoxyoxolan-3-amine;hydrochloride |
| InChIKey | ZTVZVAHORYFXKL-NDXYWBNTSA-N |
| SMILES | C1[C@H]([C@@H](CO1)OCC2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)