Products 2173991-95-0

CAS 2173991-95-0 is the registry number for 1-TERT-BUTYLPIPERIDINE-4-CARBOXYLIC ACID HCL, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g, 10g.

1-tert-butylpiperidine-4-carboxylic acid;hydrochloride (CAS 2173991-95-0) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: 1-tert-butylpiperidine-4-carboxylic acid;hydrochloride. InChIKey: LFAQLAPENPROSV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H20ClNO2
Molecular weight221.72 g/mol
IUPAC name1-tert-butylpiperidine-4-carboxylic acid;hydrochloride
InChIKeyLFAQLAPENPROSV-UHFFFAOYSA-N
SMILESCC(C)(C)N1CCC(CC1)C(=O)O.Cl

Computed by PubChem (NCBI)