Products 2173992-25-9

CAS 2173992-25-9 is the registry number for 4-(BENZYLOXY)-1H-INDOLE-7-CARBOXYLIC ACID, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

4-phenylmethoxy-1H-indole-7-carboxylic acid (CAS 2173992-25-9) is a chemical compound with the molecular formula C16H13NO3 and a molecular weight of 267.28 g/mol. IUPAC name: 4-phenylmethoxy-1H-indole-7-carboxylic acid. InChIKey: RMRZDXJACFOJMP-UHFFFAOYSA-N.

Identity
Molecular formulaC16H13NO3
Molecular weight267.28 g/mol
IUPAC name4-phenylmethoxy-1H-indole-7-carboxylic acid
InChIKeyRMRZDXJACFOJMP-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=C3C=CNC3=C(C=C2)C(=O)O

Computed by PubChem (NCBI)