CAS 217453-46-8 is the registry number for Ethyl 3-(chlorosulfonyl)benzoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Ethyl 3-chlorosulfonylbenzoate (CAS 217453-46-8) is a chemical compound with the molecular formula C9H9ClO4S and a molecular weight of 248.68 g/mol. IUPAC name: ethyl 3-chlorosulfonylbenzoate. InChIKey: OQBZLUKCZKZQFV-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4S |
|---|---|
| Molecular weight | 248.68 g/mol |
| IUPAC name | ethyl 3-chlorosulfonylbenzoate |
| InChIKey | OQBZLUKCZKZQFV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=CC=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)