Products 2179-05-7

CAS 2179-05-7 is the registry number for 3-(2,5-Dioxo-1-phenylimidazolidin-4-yl)propanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

3-(2,5-dioxo-1-phenylimidazolidin-4-yl)propanoic acid (CAS 2179-05-7) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: 3-(2,5-dioxo-1-phenylimidazolidin-4-yl)propanoic acid. InChIKey: DLATUVFNWPJQLB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12N2O4
Molecular weight248.23 g/mol
IUPAC name3-(2,5-dioxo-1-phenylimidazolidin-4-yl)propanoic acid
InChIKeyDLATUVFNWPJQLB-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N2C(=O)C(NC2=O)CCC(=O)O

Computed by PubChem (NCBI)