CAS 218608-77-6 is the registry number for (R)–3–(P–BENZYLOXYPHENYL)–BETA–ALANINE. Offered by: GLPBio. Available pack sizes: 200mg.
(3R)-3-amino-3-(4-phenylmethoxyphenyl)propanoic acid (CAS 218608-77-6) is a chemical compound with the molecular formula C16H17NO3 and a molecular weight of 271.31 g/mol. IUPAC name: (3R)-3-amino-3-(4-phenylmethoxyphenyl)propanoic acid. InChIKey: VODMAXQPPKRFPS-OAHLLOKOSA-N.
| Molecular formula | C16H17NO3 |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | (3R)-3-amino-3-(4-phenylmethoxyphenyl)propanoic acid |
| InChIKey | VODMAXQPPKRFPS-OAHLLOKOSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)