Products 2189700-02-3
CAS 2189700-02-3 is the registry number for PSB-16434. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-[2-(4-chlorophenyl)ethylamino]-1H-pyrimidine-2,4-dione (CAS 2189700-02-3) is a chemical compound with the molecular formula C12H12ClN3O2 and a molecular weight of 265.69 g/mol. IUPAC name: 6-[2-(4-chlorophenyl)ethylamino]-1H-pyrimidine-2,4-dione. InChIKey: JSUODDTVALGQAK-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3O2 |
|---|---|
| Molecular weight | 265.69 g/mol |
| IUPAC name | 6-[2-(4-chlorophenyl)ethylamino]-1H-pyrimidine-2,4-dione |
| InChIKey | JSUODDTVALGQAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCNC2=CC(=O)NC(=O)N2)Cl |
Computed by PubChem (NCBI)