CAS 21905-56-6 appears in our catalog under these names: Methyl 2–phenoxybenzoate, Methyl 2-phenoxybenzoate, 99% , Methyl 2-phenoxybenzoate 99%, Methyl 2-phenoxybenzoate, 98%, 98%, Methyl 2-phenoxybenzoate, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 50g, 500g, 100g, 1g, 250mg.
Methyl 2-phenoxybenzoate (CAS 21905-56-6) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: methyl 2-phenoxybenzoate. InChIKey: PUGYLBSXMKBSRP-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | methyl 2-phenoxybenzoate |
| InChIKey | PUGYLBSXMKBSRP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC=C1OC2=CC=CC=C2 |
Computed by PubChem (NCBI)