CAS 219508-19-7 appears in our catalog under these names: 3-Bromo-1H-indole-6-carboxylic acid, 96%, 3–Bromoindole–6–carboxylic Acid, 3-Bromo-1H-indole-6-carboxylic acid, 97%, 97%, 3-Bromoindole-6-carboxylic acid, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 25g, 1g, 5g, 100mg, 250mg.
3-bromo-1H-indole-6-carboxylic acid (CAS 219508-19-7) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 3-bromo-1H-indole-6-carboxylic acid. InChIKey: XZNVEIYDUGPMCS-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 3-bromo-1H-indole-6-carboxylic acid |
| InChIKey | XZNVEIYDUGPMCS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC=C2Br |
Computed by PubChem (NCBI)