Products 2197052-65-4

CAS 2197052-65-4 appears in our catalog under these names: 2,2-Dimethyl-3-(pyridin-4-yl)propanoic acid hydrochloride, 95%, 2,2-Dimethyl-3-(pyridin-4-yl)propanoic acid hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2,2-dimethyl-3-pyridin-4-ylpropanoic acid;hydrochloride (CAS 2197052-65-4) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 2,2-dimethyl-3-pyridin-4-ylpropanoic acid;hydrochloride. InChIKey: DWJCNHLWQFIMRS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClNO2
Molecular weight215.67 g/mol
IUPAC name2,2-dimethyl-3-pyridin-4-ylpropanoic acid;hydrochloride
InChIKeyDWJCNHLWQFIMRS-UHFFFAOYSA-N
SMILESCC(C)(CC1=CC=NC=C1)C(=O)O.Cl

Computed by PubChem (NCBI)