Products 2200278-72-2
CAS 2200278-72-2 is the registry number for 1,5:2,3-Dianhydro-4,6-O-benzylidene-D-mannitol. Offered by: Biosynth. Available pack sizes: 2000mg, 1000mg, 5000mg.
(1R,2R,4R,7R)-10-phenyl-3,6,9,11-tetraoxatricyclo[5.4.0.02,4]undecane (CAS 2200278-72-2) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: (1R,2R,4R,7R)-10-phenyl-3,6,9,11-tetraoxatricyclo[5.4.0.02,4]undecane. InChIKey: BYKNJRIVJRIKQC-JVASRFHESA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | (1R,2R,4R,7R)-10-phenyl-3,6,9,11-tetraoxatricyclo[5.4.0.02,4]undecane |
| InChIKey | BYKNJRIVJRIKQC-JVASRFHESA-N |
| SMILES | C1[C@@H]2[C@@H](O2)[C@H]3[C@H](O1)COC(O3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)