Products 220144-84-3
CAS 220144-84-3 is the registry number for H-DL-Arg-OH hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 0,25g.
2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride (CAS 220144-84-3) is a chemical compound with the molecular formula C6H15ClN4O2 and a molecular weight of 210.66 g/mol. IUPAC name: 2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride. InChIKey: KWTQSFXGGICVPE-UHFFFAOYSA-N.
| Molecular formula | C6H15ClN4O2 |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride |
| InChIKey | KWTQSFXGGICVPE-UHFFFAOYSA-N |
| SMILES | C(CC(C(=O)O)N)CN=C(N)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
DL-Arginine hydrochloride, 2-Amino-5-guanidinopentanoic acid hydrochloride, DL-Arginine xhydrochloride, DL-(+/-)-Arginine Hydrochloride, DL-Argininehydrochloridemonohydrate, 2-amino-5-carbamimidamidopentanoic acid hydrochloride, 2-amino-5-(diaminomethylideneamino)pentanoic acid;hydrochloride, Arginine monochloride, L-Arginine xhydrochloride, argininhydrochlorid