Products 22036-26-6
CAS 22036-26-6 appears in our catalog under these names: 3-(4-Aminophenyl)oxazolidin-2-one, 97%, 3-(4-Aminophenyl)-1,3-oxazolidin-2-one, 97%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-(4-aminophenyl)-1,3-oxazolidin-2-one (CAS 22036-26-6) is a chemical compound with the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. IUPAC name: 3-(4-aminophenyl)-1,3-oxazolidin-2-one. InChIKey: DDCWSJXZZUOJRT-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O2 |
|---|---|
| Molecular weight | 178.19 g/mol |
| IUPAC name | 3-(4-aminophenyl)-1,3-oxazolidin-2-one |
| InChIKey | DDCWSJXZZUOJRT-UHFFFAOYSA-N |
| SMILES | C1COC(=O)N1C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)