CAS 221050-96-0 appears in our catalog under these names: Isoquinoline–7–carboxylic acid, Isoquinoline-7-Carboxylic Acid, 98%, 98%, Isoquinoline-7-carboxylic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 25g, 5g, 10g.
Isoquinoline-7-carboxylic acid (CAS 221050-96-0) is a chemical compound with the molecular formula C10H7NO2 and a molecular weight of 173.17 g/mol. IUPAC name: isoquinoline-7-carboxylic acid. InChIKey: QUFUUBBLCOBJPH-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2 |
|---|---|
| Molecular weight | 173.17 g/mol |
| IUPAC name | isoquinoline-7-carboxylic acid |
| InChIKey | QUFUUBBLCOBJPH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CN=C2)C(=O)O |
Computed by PubChem (NCBI)