CAS 221128-49-0 is the registry number for 4–(Piperidin–1–yl)but–2–enoic acid hydrochloride. Offered by: GLPBio. Available pack sizes: 1g, 5g.
(E)-4-piperidin-1-ylbut-2-enoic acid;hydrochloride (CAS 221128-49-0) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: (E)-4-piperidin-1-ylbut-2-enoic acid;hydrochloride. InChIKey: DSQHWBRYZUFZDY-FXRZFVDSSA-N.
| Molecular formula | C9H16ClNO2 |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | (E)-4-piperidin-1-ylbut-2-enoic acid;hydrochloride |
| InChIKey | DSQHWBRYZUFZDY-FXRZFVDSSA-N |
| SMILES | C1CCN(CC1)C/C=C/C(=O)O.Cl |
Computed by PubChem (NCBI)