CAS 221225-04-3 is the registry number for Metrazoline. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, Get quote.
2-[(E)-2-(2-methylphenyl)ethenyl]-4,5-dihydro-1H-imidazole;oxalic acid (CAS 221225-04-3) is a chemical compound with the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. IUPAC name: 2-[(E)-2-(2-methylphenyl)ethenyl]-4,5-dihydro-1H-imidazole;oxalic acid. InChIKey: QDUUQIGHAAEJDO-UHDJGPCESA-N.
| Molecular formula | C14H16N2O4 |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | 2-[(E)-2-(2-methylphenyl)ethenyl]-4,5-dihydro-1H-imidazole;oxalic acid |
| InChIKey | QDUUQIGHAAEJDO-UHDJGPCESA-N |
| SMILES | CC1=CC=CC=C1/C=C/C2=NCCN2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)