Products 221374-79-4
CAS 221374-79-4 is the registry number for Radulone A. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,2S,10S,13S)-13-hydroxy-2,6,10-trimethyl-12-oxatetracyclo[8.2.1.01,8.02,5]trideca-5,8-dien-7-one (CAS 221374-79-4) is a chemical compound with the molecular formula C15H18O3 and a molecular weight of 246.30 g/mol. IUPAC name: (1S,2S,10S,13S)-13-hydroxy-2,6,10-trimethyl-12-oxatetracyclo[8.2.1.01,8.02,5]trideca-5,8-dien-7-one. InChIKey: CKIYXOQTOZHRAN-AJNGGQMLSA-N.
| Molecular formula | C15H18O3 |
|---|---|
| Molecular weight | 246.30 g/mol |
| IUPAC name | (1S,2S,10S,13S)-13-hydroxy-2,6,10-trimethyl-12-oxatetracyclo[8.2.1.01,8.02,5]trideca-5,8-dien-7-one |
| InChIKey | CKIYXOQTOZHRAN-AJNGGQMLSA-N |
| SMILES | CC1=C2CC[C@@]2([C@]34[C@H]([C@](CO3)(C=C4C1=O)C)O)C |
Computed by PubChem (NCBI)
Synonyms:
Radulone A, orb2646002