Products 2225127-01-3
CAS 2225127-01-3 appears in our catalog under these names: tert-Butyl (2R)-2-methylpyrrolidine-2-carboxylate hydrochloride, tert-butyl (2R)-2-methylpyrrolidine-2-carboxylate hydrochloride, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 2,5g, 100mg, 250mg, 500mg, 1g, 5g.
Tert-butyl (2R)-2-methylpyrrolidine-2-carboxylate;hydrochloride (CAS 2225127-01-3) is a chemical compound with the molecular formula C10H20ClNO2 and a molecular weight of 221.72 g/mol. IUPAC name: tert-butyl (2R)-2-methylpyrrolidine-2-carboxylate;hydrochloride. InChIKey: PUPXZFJVMVNJPV-HNCPQSOCSA-N.
| Molecular formula | C10H20ClNO2 |
|---|---|
| Molecular weight | 221.72 g/mol |
| IUPAC name | tert-butyl (2R)-2-methylpyrrolidine-2-carboxylate;hydrochloride |
| InChIKey | PUPXZFJVMVNJPV-HNCPQSOCSA-N |
| SMILES | C[C@@]1(CCCN1)C(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)