CAS 2225141-39-7 appears in our catalog under these names: 1-(2,2-Dimethyl-1,3-dioxaindan-5-yl)methanamine hydrochloride, (2,2-Dimethylbenzo[d][1,3]dioxol-5-yl)methanamine hydrochloride, 97%, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 500mg, 1g.
(2,2-dimethyl-1,3-benzodioxol-5-yl)methanamine;hydrochloride (CAS 2225141-39-7) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: (2,2-dimethyl-1,3-benzodioxol-5-yl)methanamine;hydrochloride. InChIKey: KREPEWWSIMOJMO-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | (2,2-dimethyl-1,3-benzodioxol-5-yl)methanamine;hydrochloride |
| InChIKey | KREPEWWSIMOJMO-UHFFFAOYSA-N |
| SMILES | CC1(OC2=C(O1)C=C(C=C2)CN)C.Cl |
Computed by PubChem (NCBI)