CAS 2225152-00-9 is the registry number for 2–(sec–Butyl–d9)–6–fluoropyridine–4–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-fluoro-6-(1,1,1,2,3,3,4,4,4-nonadeuteriobutan-2-yl)-4-pyridinyl]boronic acid (CAS 2225152-00-9) is a chemical compound with the molecular formula C9H13BFNO2 and a molecular weight of 206.07 g/mol. IUPAC name: [2-fluoro-6-(1,1,1,2,3,3,4,4,4-nonadeuteriobutan-2-yl)-4-pyridinyl]boronic acid. InChIKey: DJZJLYGHTRWJQQ-GMFBVPFISA-N.
| Molecular formula | C9H13BFNO2 |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | [2-fluoro-6-(1,1,1,2,3,3,4,4,4-nonadeuteriobutan-2-yl)-4-pyridinyl]boronic acid |
| InChIKey | DJZJLYGHTRWJQQ-GMFBVPFISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])(C1=NC(=CC(=C1)B(O)O)F)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)