CAS 2225174-01-4 is the registry number for 2–(iso–Propyl–d7)–pyridine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-3-pyridinyl]boronic acid (CAS 2225174-01-4) is a chemical compound with the molecular formula C8H12BNO2 and a molecular weight of 172.04 g/mol. IUPAC name: [6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-3-pyridinyl]boronic acid. InChIKey: BOEITCPLEOEZLF-NWOXSKRJSA-N.
| Molecular formula | C8H12BNO2 |
|---|---|
| Molecular weight | 172.04 g/mol |
| IUPAC name | [6-(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-3-pyridinyl]boronic acid |
| InChIKey | BOEITCPLEOEZLF-NWOXSKRJSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C1=NC=C(C=C1)B(O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)