CAS 22266-99-5 is the registry number for 5-Methoxy-2-methyl-1,4-naphthoquinone. Offered by: TRC. Available pack sizes: 2,5g.
5-methoxy-2-methylnaphthalene-1,4-dione (CAS 22266-99-5) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 5-methoxy-2-methylnaphthalene-1,4-dione. InChIKey: ITNOIFSYUBMQKB-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 5-methoxy-2-methylnaphthalene-1,4-dione |
| InChIKey | ITNOIFSYUBMQKB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C2=C(C1=O)C=CC=C2OC |
Computed by PubChem (NCBI)