CAS 2227733-14-2 is the registry number for (R)-1-(4-Bromo-3-fluorophenyl)-2,2,2-trifluoroethan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(4-bromo-3-fluorophenyl)-2,2,2-trifluoroethanol (CAS 2227733-14-2) is a chemical compound with the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. IUPAC name: (1R)-1-(4-bromo-3-fluorophenyl)-2,2,2-trifluoroethanol. InChIKey: HTLCYPHJYHOWFB-SSDOTTSWSA-N.
| Molecular formula | C8H5BrF4O |
|---|---|
| Molecular weight | 273.02 g/mol |
| IUPAC name | (1R)-1-(4-bromo-3-fluorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | HTLCYPHJYHOWFB-SSDOTTSWSA-N |
| SMILES | C1=CC(=C(C=C1[C@H](C(F)(F)F)O)F)Br |
Computed by PubChem (NCBI)