CAS 2092564-68-4 appears in our catalog under these names: 3-Bromo-2-fluoro-5-(trifluoromethyl)benzyl alcohol, 95%, 3-Bromo-2-fluoro-5-(trifluoromethyl)benzyl alcohol, ≥95%, ≥95%, 3-Bromo-2-fluoro-5-(trifluoromethyl)benzyl alcohol, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
[3-bromo-2-fluoro-5-(trifluoromethyl)phenyl]methanol (CAS 2092564-68-4) is a chemical compound with the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. IUPAC name: [3-bromo-2-fluoro-5-(trifluoromethyl)phenyl]methanol. InChIKey: WMVAVELEYDTMRF-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4O |
|---|---|
| Molecular weight | 273.02 g/mol |
| IUPAC name | [3-bromo-2-fluoro-5-(trifluoromethyl)phenyl]methanol |
| InChIKey | WMVAVELEYDTMRF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1CO)F)Br)C(F)(F)F |
Computed by PubChem (NCBI)