Products 86256-24-8
CAS 86256-24-8 appears in our catalog under these names: 2-Fluoro-5-(trifluoromethoxy)benzyl bromide, 95%, 2-Fluoro-5-(trifluoromethoxy)benzyl bromide, 98+%, 2-Fluoro-5-(trifluoromethoxy)benzyl bromide, 97% . Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g, 250mg.
2-(bromomethyl)-1-fluoro-4-(trifluoromethoxy)benzene (CAS 86256-24-8) is a chemical compound with the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. IUPAC name: 2-(bromomethyl)-1-fluoro-4-(trifluoromethoxy)benzene. InChIKey: KOISGBFWQAPLFE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4O |
|---|---|
| Molecular weight | 273.02 g/mol |
| IUPAC name | 2-(bromomethyl)-1-fluoro-4-(trifluoromethoxy)benzene |
| InChIKey | KOISGBFWQAPLFE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)CBr)F |
Computed by PubChem (NCBI)