CAS 68834-05-9 is the registry number for 1-Bromo-4-(tetrafluoroethoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1-bromo-4-(1,1,2,2-tetrafluoroethoxy)benzene (CAS 68834-05-9) is a chemical compound with the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. IUPAC name: 1-bromo-4-(1,1,2,2-tetrafluoroethoxy)benzene. InChIKey: VKJYIOCMIHTAET-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4O |
|---|---|
| Molecular weight | 273.02 g/mol |
| IUPAC name | 1-bromo-4-(1,1,2,2-tetrafluoroethoxy)benzene |
| InChIKey | VKJYIOCMIHTAET-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC(C(F)F)(F)F)Br |
Computed by PubChem (NCBI)