CAS 200956-26-9 appears in our catalog under these names: 2-Bromo-4-fluoro-1-(2,2,2-trifluoroethoxy)benzene, 98%, 2-Bromo-4-fluoro-1-(2,2,2-trifluoroethoxy)benzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 25g, 1g, 5g, 2,5g.
2-bromo-4-fluoro-1-(2,2,2-trifluoroethoxy)benzene (CAS 200956-26-9) is a chemical compound with the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. IUPAC name: 2-bromo-4-fluoro-1-(2,2,2-trifluoroethoxy)benzene. InChIKey: OMKBUDDSVHSRTC-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4O |
|---|---|
| Molecular weight | 273.02 g/mol |
| IUPAC name | 2-bromo-4-fluoro-1-(2,2,2-trifluoroethoxy)benzene |
| InChIKey | OMKBUDDSVHSRTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)OCC(F)(F)F |
Computed by PubChem (NCBI)