CAS 2090471-09-1 is the registry number for 1-Bromo-3-fluoro-2-methoxy-5-(trifluoromethyl)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
1-bromo-3-fluoro-2-methoxy-5-(trifluoromethyl)benzene (CAS 2090471-09-1) is a chemical compound with the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. IUPAC name: 1-bromo-3-fluoro-2-methoxy-5-(trifluoromethyl)benzene. InChIKey: CUGPLNZBERFGQN-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4O |
|---|---|
| Molecular weight | 273.02 g/mol |
| IUPAC name | 1-bromo-3-fluoro-2-methoxy-5-(trifluoromethyl)benzene |
| InChIKey | CUGPLNZBERFGQN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Br)C(F)(F)F)F |
Computed by PubChem (NCBI)