Products 2090690-37-0
CAS 2090690-37-0 appears in our catalog under these names: 2-Bromo-6-fluoro-3-(trifluoromethyl)benzyl alcohol, 95%, (2-Bromo-6-fluoro-3-(trifluoromethyl)phenyl)methanol, 95%, 2-Bromo-6-fluoro-3-(trifluoromethyl)benzyl alcohol. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
[2-bromo-6-fluoro-3-(trifluoromethyl)phenyl]methanol (CAS 2090690-37-0) is a chemical compound with the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. IUPAC name: [2-bromo-6-fluoro-3-(trifluoromethyl)phenyl]methanol. InChIKey: PQUDLEDEMZMCMP-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4O |
|---|---|
| Molecular weight | 273.02 g/mol |
| IUPAC name | [2-bromo-6-fluoro-3-(trifluoromethyl)phenyl]methanol |
| InChIKey | PQUDLEDEMZMCMP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)Br)CO)F |
Computed by PubChem (NCBI)