CAS 2227897-53-0 is the registry number for rac-(1R,2R)-2-(Quinolin-4-yl)cyclopropane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 25mg, 0,25g.
Trans-(1R,2R)-2-quinolin-4-ylcyclopropane-1-carboxylic acid (CAS 2227897-53-0) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: trans-(1R,2R)-2-quinolin-4-ylcyclopropane-1-carboxylic acid. InChIKey: AJMOJSADAZCTDI-WDEREUQCSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | trans-(1R,2R)-2-quinolin-4-ylcyclopropane-1-carboxylic acid |
| InChIKey | AJMOJSADAZCTDI-WDEREUQCSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC=NC3=CC=CC=C23 |
Computed by PubChem (NCBI)