Products 2228087-26-9
CAS 2228087-26-9 is the registry number for 2-tert-Butyl-6-methyl-1,1-dioxo-1λâ¶,2-thiazinane-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-tert-butyl-6-methyl-1,1-dioxothiazinane-6-carboxylic acid (CAS 2228087-26-9) is a chemical compound with the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. IUPAC name: 2-tert-butyl-6-methyl-1,1-dioxothiazinane-6-carboxylic acid. InChIKey: POPBOQMJICJEBP-UHFFFAOYSA-N.
| Molecular formula | C10H19NO4S |
|---|---|
| Molecular weight | 249.33 g/mol |
| IUPAC name | 2-tert-butyl-6-methyl-1,1-dioxothiazinane-6-carboxylic acid |
| InChIKey | POPBOQMJICJEBP-UHFFFAOYSA-N |
| SMILES | CC1(CCCN(S1(=O)=O)C(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)