Products 2228190-82-5

CAS 2228190-82-5 is the registry number for 2-Oxo-3-(quinolin-6-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-oxo-3-quinolin-6-ylpropanoic acid (CAS 2228190-82-5) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 2-oxo-3-quinolin-6-ylpropanoic acid. InChIKey: QYXDDNWWEHPSTC-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9NO3
Molecular weight215.20 g/mol
IUPAC name2-oxo-3-quinolin-6-ylpropanoic acid
InChIKeyQYXDDNWWEHPSTC-UHFFFAOYSA-N
SMILESC1=CC2=C(C=CC(=C2)CC(=O)C(=O)O)N=C1

Computed by PubChem (NCBI)