Products 2228465-74-3
CAS 2228465-74-3 is the registry number for (2,2-Difluoro-1-phenylcyclopropyl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(2,2-difluoro-1-phenylcyclopropyl)methanamine;hydrochloride (CAS 2228465-74-3) is a chemical compound with the molecular formula C10H12ClF2N and a molecular weight of 219.66 g/mol. IUPAC name: (2,2-difluoro-1-phenylcyclopropyl)methanamine;hydrochloride. InChIKey: JBJCECQMEDNXDK-UHFFFAOYSA-N.
| Molecular formula | C10H12ClF2N |
|---|---|
| Molecular weight | 219.66 g/mol |
| IUPAC name | (2,2-difluoro-1-phenylcyclopropyl)methanamine;hydrochloride |
| InChIKey | JBJCECQMEDNXDK-UHFFFAOYSA-N |
| SMILES | C1C(C1(F)F)(CN)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)